Products 77739-84-5

CAS 77739-84-5 is the registry number for 8-Ethylquinoline-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

8-ethylquinoline-2-carboxylic acid (CAS 77739-84-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 8-ethylquinoline-2-carboxylic acid. InChIKey: XFOPGCOCCTWKAM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO2
Molecular weight201.22 g/mol
IUPAC name8-ethylquinoline-2-carboxylic acid
InChIKeyXFOPGCOCCTWKAM-UHFFFAOYSA-N
SMILESCCC1=CC=CC2=C1N=C(C=C2)C(=O)O

Computed by PubChem (NCBI)