Products 77774-24-4
CAS 77774-24-4 is the registry number for N-Nitrosonorcodeine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
9-methoxy-3-nitroso-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol (CAS 77774-24-4) is a chemical compound with the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. IUPAC name: 9-methoxy-3-nitroso-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol. InChIKey: NGNCKOKHKZDIHF-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4 |
|---|---|
| Molecular weight | 314.34 g/mol |
| IUPAC name | 9-methoxy-3-nitroso-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| InChIKey | NGNCKOKHKZDIHF-UHFFFAOYSA-N |
| SMILES | COC1=C2C3=C(CC4C5C3(CCN4N=O)C(O2)C(C=C5)O)C=C1 |
Computed by PubChem (NCBI)