CAS 778571-53-2 is the registry number for (R)-3-Amino-3-(2,4-dichloro-phenyl)-propionic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid (CAS 778571-53-2) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: (3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid. InChIKey: QGHQDRDWQIHGKZ-MRVPVSSYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(2,4-dichlorophenyl)propanoic acid |
| InChIKey | QGHQDRDWQIHGKZ-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)