CAS 781654-31-7 appears in our catalog under these names: 3-Bromo-4,5-dimethoxybenzonitrile, 97%, 97%, 3-BROMO-4,5-DIMETHOXYBENZONITRILE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-bromo-4,5-dimethoxybenzonitrile (CAS 781654-31-7) is a chemical compound with the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. IUPAC name: 3-bromo-4,5-dimethoxybenzonitrile. InChIKey: PTCVIEQABWPBTA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO2 |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 3-bromo-4,5-dimethoxybenzonitrile |
| InChIKey | PTCVIEQABWPBTA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C#N)Br)OC |
Computed by PubChem (NCBI)