CAS 78196-74-4 appears in our catalog under these names: Naphthalene-1,2-diaminedihydrochloride, 95%, 95%, NAPHTHALENE-1,2-DIAMINE DIHYDROCHLORIDE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Naphthalene-1,2-diamine;dihydrochloride (CAS 78196-74-4) is a chemical compound with the molecular formula C10H12Cl2N2 and a molecular weight of 231.12 g/mol. IUPAC name: naphthalene-1,2-diamine;dihydrochloride. InChIKey: HGHCAGCTHJZWTD-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | naphthalene-1,2-diamine;dihydrochloride |
| InChIKey | HGHCAGCTHJZWTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2N)N.Cl.Cl |
Computed by PubChem (NCBI)