Products 78202-43-4
CAS 78202-43-4 is the registry number for methyl 5-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 5-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate (CAS 78202-43-4) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: methyl 5-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate. InChIKey: PKFOWMLPMPQRGJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | methyl 5-methyl-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| InChIKey | PKFOWMLPMPQRGJ-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=O)NC1=O)C(=O)OC |
Computed by PubChem (NCBI)