Products 78239-47-1
CAS 78239-47-1 is the registry number for Tiaprofenic acid impurity C. Offered by: Sigma-Aldrich. Available pack sizes: -.
2-(5-benzoylthiophen-3-yl)propanoic acid (CAS 78239-47-1) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 2-(5-benzoylthiophen-3-yl)propanoic acid. InChIKey: BUBACEWLLQCUAX-UHFFFAOYSA-N.
| Molecular formula | C14H12O3S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 2-(5-benzoylthiophen-3-yl)propanoic acid |
| InChIKey | BUBACEWLLQCUAX-UHFFFAOYSA-N |
| SMILES | CC(C1=CSC(=C1)C(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2RS)-2-(5-Benzoylthiophen-3-yl)propanoic acid, Tiaprofenic acid impurity C [EP], 5-Benzoyl-alpha-methyl-3-thiopheneacetic acid, 3-Thiopheneacetic acid, 5-benzoyl-alpha-methyl-, TIAPROFENIC ACID IMPURITY C [EP IMPURITY], TIAPROFENIC ACID IMPURITY C (EP IMPURITY), Tiaprofenic acid impurity C, 2-(5-Benzoyl-3-thienyl)propanoic acid, 2-(5-benzoylthiophen-3-yl)propanoic acid, Tiaprofenic Acid Impurity 1