Products 78288-94-5
CAS 78288-94-5 appears in our catalog under these names: 7-Nitro-3,4-dihydro-2h-1,5-benzodioxepine, 97%, 7–Nitro–3，4–dihydro–2H–1，5–benzodioxepine, 7-Nitro-3,4-dihydro-2H-1,5-benzodioxepine, 7-Nitro-3，4-dihydro-2H-1，5-benzodioxepine, >97%, >97%, 7-Nitro-3,4-dihydro-2H-benzo[b][1,4]dioxepine, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
7-nitro-3,4-dihydro-2H-1,5-benzodioxepine (CAS 78288-94-5) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: DYLOYOGDBJZJDV-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | DYLOYOGDBJZJDV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)[N+](=O)[O-])OC1 |
Computed by PubChem (NCBI)