Products 78311-97-4
CAS 78311-97-4 is the registry number for 5(4H)-Oxazolone, 2-Methyl-4-[(3-Methylphenyl)Methylene]-, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-methyl-4-[(3-methylphenyl)methylidene]-1,3-oxazol-5-one (CAS 78311-97-4) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-methyl-4-[(3-methylphenyl)methylidene]-1,3-oxazol-5-one. InChIKey: OHFJJNFSSSCWTL-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-methyl-4-[(3-methylphenyl)methylidene]-1,3-oxazol-5-one |
| InChIKey | OHFJJNFSSSCWTL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C=C2C(=O)OC(=N2)C |
Computed by PubChem (NCBI)