CAS 78411-55-9 is the registry number for 2-Methyl-7-methylamino-8-nitro-quinoxaline, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
N,3-dimethyl-5-nitroquinoxalin-6-amine (CAS 78411-55-9) is a chemical compound with the molecular formula C10H10N4O2 and a molecular weight of 218.21 g/mol. IUPAC name: N,3-dimethyl-5-nitroquinoxalin-6-amine. InChIKey: RWEGKKUGBIGLRG-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | N,3-dimethyl-5-nitroquinoxalin-6-amine |
| InChIKey | RWEGKKUGBIGLRG-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C=CC(=C(C2=N1)[N+](=O)[O-])NC |
Computed by PubChem (NCBI)