Products 784172-01-6
CAS 784172-01-6 appears in our catalog under these names: 5-[(tert-Butylamino)sulfonyl]-2-methylbenzoic acid, 95%, 5-(N-(tert-Butyl)sulfamoyl)-2-methylbenzoic acid, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(tert-butylsulfamoyl)-2-methylbenzoic acid (CAS 784172-01-6) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 5-(tert-butylsulfamoyl)-2-methylbenzoic acid. InChIKey: IIROBGLFXFAJHS-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 5-(tert-butylsulfamoyl)-2-methylbenzoic acid |
| InChIKey | IIROBGLFXFAJHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(tert-butylsulfamoyl)-2-methylbenzoic acid, 5-[(tert-butylamino)sulfonyl]-2-methylbenzoic acid, 5-(N-(tert-Butyl)sulfamoyl)-2-methylbenzoic acid, 5-(tert-butylsulfamoyl)-2-methylbenzoicacid, 5-(tert-butylsulfamoyl)-2-methyl-benzoic acid, Benzoic acid, 5-[[(1,1-dimethylethyl)amino]sulfonyl]-2-methyl-