CAS 78433-88-2 appears in our catalog under these names: 2–(2,6–Dichlorophenyl)acetamide, 2-(2,6-Dichlorophenyl)acetamide 97%, 2-(2,6-Dichlorophenyl)acetamide, 98%, Guanfacine Impurity 6, 2,6-Dichlorophenylacetamide. Offered by: GLPBio, Ambeed, Fluorochem, Chemat Brand, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10g, on request, 100mg.
2-(2,6-dichlorophenyl)acetamide (CAS 78433-88-2) is a chemical compound with the molecular formula C8H7Cl2NO and a molecular weight of 204.05 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)acetamide. InChIKey: KEPLFZWNVMCJLI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO |
|---|---|
| Molecular weight | 204.05 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)acetamide |
| InChIKey | KEPLFZWNVMCJLI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)N)Cl |
Computed by PubChem (NCBI)