CAS 78452-55-8 appears in our catalog under these names: (R)–2–((tert–Butoxycarbonyl)amino)–3–(thiophen–2–yl)propanoic acid, Boc-D-2-thienylalanine, 95%, 95%, (R)-2-((tert-Butoxycarbonyl)amino)-3-(thiophen-2-yl)propanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid (CAS 78452-55-8) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid. InChIKey: OJLISTAWQHSIHL-SECBINFHSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoic acid |
| InChIKey | OJLISTAWQHSIHL-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=CS1)C(=O)O |
Computed by PubChem (NCBI)