CAS 78582-85-1 is the registry number for Ac-Gly-Tyr-NH2, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2-acetamidoacetyl)amino]-3-(4-hydroxyphenyl)propanamide (CAS 78582-85-1) is a chemical compound with the molecular formula C13H17N3O4 and a molecular weight of 279.29 g/mol. IUPAC name: (2S)-2-[(2-acetamidoacetyl)amino]-3-(4-hydroxyphenyl)propanamide. InChIKey: SHVUIMUPUKFKEB-NSHDSACASA-N.
| Molecular formula | C13H17N3O4 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-2-[(2-acetamidoacetyl)amino]-3-(4-hydroxyphenyl)propanamide |
| InChIKey | SHVUIMUPUKFKEB-NSHDSACASA-N |
| SMILES | CC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N |
Computed by PubChem (NCBI)