Products 78686-81-4
CAS 78686-81-4 is the registry number for METHYL 5,6-DIBROMONICOTINATE, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 5,6-dibromopyridine-3-carboxylate (CAS 78686-81-4) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: methyl 5,6-dibromopyridine-3-carboxylate. InChIKey: MREUKHWWRWXJLN-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | methyl 5,6-dibromopyridine-3-carboxylate |
| InChIKey | MREUKHWWRWXJLN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Br)Br |
Computed by PubChem (NCBI)