Products 139194-80-2
CAS 139194-80-2 appears in our catalog under these names: 1-Bromo-3-(bromomethyl)-5-nitrobenzene, 96%, 3-Bromo-5-nitrobenzyl bromide, 1-Bromo-3-(bromomethyl)-5-nitrobenzene 96%. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,5g, 100mg.
1-bromo-3-(bromomethyl)-5-nitrobenzene (CAS 139194-80-2) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1-bromo-3-(bromomethyl)-5-nitrobenzene. InChIKey: LUTXVMDOMLHNIX-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1-bromo-3-(bromomethyl)-5-nitrobenzene |
| InChIKey | LUTXVMDOMLHNIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])Br)CBr |
Computed by PubChem (NCBI)