Products 939-82-2
CAS 939-82-2 appears in our catalog under these names: 1–Bromo–2–(bromomethyl)–4–nitrobenzene, 1-Bromo-2-(bromomethyl)-4-nitrobenzene, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-bromo-2-(bromomethyl)-4-nitrobenzene (CAS 939-82-2) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-4-nitrobenzene. InChIKey: VRBRXANSVKZSAK-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1-bromo-2-(bromomethyl)-4-nitrobenzene |
| InChIKey | VRBRXANSVKZSAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)Br |
Computed by PubChem (NCBI)