Products 495416-04-1
CAS 495416-04-1 is the registry number for Methyl 3,6-dibromopicolinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Methyl 3,6-dibromopyridine-2-carboxylate (CAS 495416-04-1) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: methyl 3,6-dibromopyridine-2-carboxylate. InChIKey: JJCLRVOXIRHZCR-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | methyl 3,6-dibromopyridine-2-carboxylate |
| InChIKey | JJCLRVOXIRHZCR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=N1)Br)Br |
Computed by PubChem (NCBI)