CAS 65962-15-4 appears in our catalog under these names: 3-Nitro-o-dibromomethyl benzene, 95%, 1–(Dibromomethyl)–2–nitrobenzene, 1-(Dibromomethyl)-2-nitrobenzene, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
1-(dibromomethyl)-2-nitrobenzene (CAS 65962-15-4) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1-(dibromomethyl)-2-nitrobenzene. InChIKey: HETXONIWLNSRGY-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1-(dibromomethyl)-2-nitrobenzene |
| InChIKey | HETXONIWLNSRGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)