CAS 82617-49-0 appears in our catalog under these names: 2-Bromo-1-(bromomethyl)-3-nitrobenzene, 95%, 2–Bromo–1–(bromomethyl)–3–nitrobenzene, 2-Bromo-3-nitrobenzyl bromide. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg, 0,1g.
2-bromo-1-(bromomethyl)-3-nitrobenzene (CAS 82617-49-0) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2-bromo-1-(bromomethyl)-3-nitrobenzene. InChIKey: IMFSHMCSISIQIN-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2-bromo-1-(bromomethyl)-3-nitrobenzene |
| InChIKey | IMFSHMCSISIQIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])Br)CBr |
Computed by PubChem (NCBI)