Products 787580-95-4

CAS 787580-95-4 is the registry number for 3-Hydroxy-1H-indazole-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-oxo-1,2-dihydroindazole-7-carboxylic acid (CAS 787580-95-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-oxo-1,2-dihydroindazole-7-carboxylic acid. InChIKey: BKYMFKQYOGIKIH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O3
Molecular weight178.14 g/mol
IUPAC name3-oxo-1,2-dihydroindazole-7-carboxylic acid
InChIKeyBKYMFKQYOGIKIH-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)C(=O)O)NNC2=O

Computed by PubChem (NCBI)