CAS 787580-95-4 is the registry number for 3-Hydroxy-1H-indazole-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-oxo-1,2-dihydroindazole-7-carboxylic acid (CAS 787580-95-4) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 3-oxo-1,2-dihydroindazole-7-carboxylic acid. InChIKey: BKYMFKQYOGIKIH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroindazole-7-carboxylic acid |
| InChIKey | BKYMFKQYOGIKIH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NNC2=O |
Computed by PubChem (NCBI)