Products 789-89-9
CAS 789-89-9 is the registry number for 3-[3,5-Bis(1,1-dimethylethyl)-4-hydroxyphenyl]-2-propenal, 95%. Offered by: Chemat. Available pack sizes: 100mg.
3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enal (CAS 789-89-9) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: 3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enal. InChIKey: PEJOWYPEAWNWJV-UHFFFAOYSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)prop-2-enal |
| InChIKey | PEJOWYPEAWNWJV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=CC=O |
Computed by PubChem (NCBI)