Products 79025-28-8
CAS 79025-28-8 appears in our catalog under these names: 3，4–Dimethoxy–2–nitrobenzoic acid, 3,4-Dimethoxy-2-nitrobenzoic acid 95%, 3,4-Dimethoxy-2-nitrobenzoic acid, 95%, 95%, 3,4-Dimethoxy-2-nitrobenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
3,4-dimethoxy-2-nitrobenzoic acid (CAS 79025-28-8) is a chemical compound with the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. IUPAC name: 3,4-dimethoxy-2-nitrobenzoic acid. InChIKey: QZYYEGRMWJAHBY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO6 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3,4-dimethoxy-2-nitrobenzoic acid |
| InChIKey | QZYYEGRMWJAHBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)