Products 791615-75-3
CAS 791615-75-3 appears in our catalog under these names: 3–Amino–2–(4–chlorobenzyl)propanoic Acid, 3-AMINO-2-(4-CHLOROBENZYL)PROPANOIC ACID, 2-Aminomethyl-3-(4-chloro-phenyl)-propionic acid, 2-Aminomethyl-3-(4-chloro-phenyl)-propionic acid, 95%. Offered by: GLPBio, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 50mg, 250mg, 1g.
2-(aminomethyl)-3-(4-chlorophenyl)propanoic acid (CAS 791615-75-3) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 2-(aminomethyl)-3-(4-chlorophenyl)propanoic acid. InChIKey: DHPVJZGGWAJJBV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-(aminomethyl)-3-(4-chlorophenyl)propanoic acid |
| InChIKey | DHPVJZGGWAJJBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(CN)C(=O)O)Cl |
Computed by PubChem (NCBI)