CAS 79208-84-7 appears in our catalog under these names: 6'-Bromospiro(cyclopentane-1,3'-indolin)-2'-one, 98%, 6'-Bromo-1',2'-dihydrospiro(cyclopentane-1,3'-indole)-2'-one, 6'-Bromospiro[cyclopentane-1,3'-indolin]-2'-one, 98%, 98%, 6'-Bromospiro[cyclopentane-1,3'-indolin]-2'-one, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 100mg.
6-bromospiro[1H-indole-3,1'-cyclopentane]-2-one (CAS 79208-84-7) is a chemical compound with the molecular formula C12H12BrNO and a molecular weight of 266.13 g/mol. IUPAC name: 6-bromospiro[1H-indole-3,1'-cyclopentane]-2-one. InChIKey: ZMPCUZFOHRIVNY-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO |
|---|---|
| Molecular weight | 266.13 g/mol |
| IUPAC name | 6-bromospiro[1H-indole-3,1'-cyclopentane]-2-one |
| InChIKey | ZMPCUZFOHRIVNY-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C3=C(C=C(C=C3)Br)NC2=O |
Computed by PubChem (NCBI)