Products 794576-60-6
CAS 794576-60-6 is the registry number for N-(2,3-Dihydro-1H-inden-5-yl)benzofuran-2-carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
N-(2,3-dihydro-1H-inden-5-yl)-1-benzofuran-2-carboxamide (CAS 794576-60-6) is a chemical compound with the molecular formula C18H15NO2 and a molecular weight of 277.3 g/mol. IUPAC name: N-(2,3-dihydro-1H-inden-5-yl)-1-benzofuran-2-carboxamide. InChIKey: CCGGZVBFGUPEQD-UHFFFAOYSA-N.
| Molecular formula | C18H15NO2 |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | N-(2,3-dihydro-1H-inden-5-yl)-1-benzofuran-2-carboxamide |
| InChIKey | CCGGZVBFGUPEQD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)NC(=O)C3=CC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)