Products 796038-21-6
CAS 796038-21-6 is the registry number for (+)-(3R)-3-Amino-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
(3R)-3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 796038-21-6) is a chemical compound with the molecular formula C15H13N3O and a molecular weight of 251.28 g/mol. IUPAC name: (3R)-3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: GLUWBSPUUGLXCW-CQSZACIVSA-N.
| Molecular formula | C15H13N3O |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | (3R)-3-amino-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | GLUWBSPUUGLXCW-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C2=N[C@H](C(=O)NC3=CC=CC=C32)N |
Computed by PubChem (NCBI)