Products 796865-82-2
CAS 796865-82-2 is the registry number for N-Formyl Varenicline. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 2mg, 1mg, 5mg.
(1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carbaldehyde (CAS 796865-82-2) is a chemical compound with the molecular formula C14H13N3O and a molecular weight of 239.27 g/mol. IUPAC name: (1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carbaldehyde. InChIKey: WFXWKRXICPYTSW-AOOOYVTPSA-N.
| Molecular formula | C14H13N3O |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | (1S,12R)-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4,6,8,10-pentaene-14-carbaldehyde |
| InChIKey | WFXWKRXICPYTSW-AOOOYVTPSA-N |
| SMILES | C1[C@@H]2CN(C[C@H]1C3=CC4=NC=CN=C4C=C23)C=O |
Computed by PubChem (NCBI)