CAS 80047-38-7 appears in our catalog under these names: Milrinone Impurity 7, Milrinone Impurity G, Milrinone Impurity 12, 5-Decyano 5-Carboxymilrinone, >95% (HPLC), 5-Decyano 5-carboxymilrinone. Offered by: Hubei YoungXin, Chemat Brand, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 250mg, 5000mg.
6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carboxylic acid (CAS 80047-38-7) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carboxylic acid. InChIKey: TWACACMBUVITDN-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carboxylic acid |
| InChIKey | TWACACMBUVITDN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C(=O)O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)