CAS 801215-24-7 appears in our catalog under these names: Acetaminophen Impurity 11, Acetaminophen Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
(4-acetamidophenyl) (2S)-2-amino-4-methylpentanoate (CAS 801215-24-7) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: (4-acetamidophenyl) (2S)-2-amino-4-methylpentanoate. InChIKey: KFMAPHMVBYUREO-ZDUSSCGKSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | (4-acetamidophenyl) (2S)-2-amino-4-methylpentanoate |
| InChIKey | KFMAPHMVBYUREO-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC1=CC=C(C=C1)NC(=O)C)N |
Computed by PubChem (NCBI)