Products 80143-57-3
CAS 80143-57-3 appears in our catalog under these names: L-Glutamine-15N, >95% (HPLC), L-Glutamine 15N, 98% +98%atom%15N, L–Glutamine 15N, L-GLUTAMINE-AMINE-15N, 98 ATOM % 15N, L-Glutamine-15N. Offered by: TRC, AmBeed, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 5mg, 1G, 100 mg, 5 mg, 10 mg.
(2S)-5-amino-2-(15N)azanyl-5-oxopentanoic acid (CAS 80143-57-3) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 147.14 g/mol. IUPAC name: (2S)-5-amino-2-(15N)azanyl-5-oxopentanoic acid. InChIKey: ZDXPYRJPNDTMRX-OGWWSMAPSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 147.14 g/mol |
| IUPAC name | (2S)-5-amino-2-(15N)azanyl-5-oxopentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-OGWWSMAPSA-N |
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)