Products 80238-38-6

CAS 80238-38-6 is the registry number for 2-(2-Acetylhydrazineylidene)-2-phenylacetic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid (CAS 80238-38-6) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: (2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid. InChIKey: FINCVADLYATHML-FMIVXFBMSA-N.

Identity
Molecular formulaC10H10N2O3
Molecular weight206.20 g/mol
IUPAC name(2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid
InChIKeyFINCVADLYATHML-FMIVXFBMSA-N
SMILESCC(=O)N/N=C(\C1=CC=CC=C1)/C(=O)O

Computed by PubChem (NCBI)