CAS 97509-70-1 is the registry number for (E)–2–(2–Acetylhydrazono)–2–phenylacetic acid. Offered by: GLPBio. Available pack sizes: 100mg.
(2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid (CAS 97509-70-1) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: (2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid. InChIKey: FINCVADLYATHML-FMIVXFBMSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | (2E)-2-(acetylhydrazinylidene)-2-phenylacetic acid |
| InChIKey | FINCVADLYATHML-FMIVXFBMSA-N |
| SMILES | CC(=O)N/N=C(\C1=CC=CC=C1)/C(=O)O |
Computed by PubChem (NCBI)