CAS 80420-88-8 appears in our catalog under these names: 4-(Pyridin-4-yl)benzene-1,2-diamine, 4-(Pyridin-4-yl)benzene-1,2-diamine, 95%, 95%, 4-(Pyridin-4-yl)benzene-1,2-diamine, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
4-pyridin-4-ylbenzene-1,2-diamine (CAS 80420-88-8) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 4-pyridin-4-ylbenzene-1,2-diamine. InChIKey: BOZAGTUANUIVTL-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-pyridin-4-ylbenzene-1,2-diamine |
| InChIKey | BOZAGTUANUIVTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=NC=C2)N)N |
Computed by PubChem (NCBI)