CAS 80657-17-6 appears in our catalog under these names: 17α-Trenbolone, Trenbolone Impurity 5, 17Alpha-Trenbolone (1.0mg/ml in Acetonitrile), 17a-Trenbolone, >95% (HPLC), 17Alpha-Trenbolone, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1x1ml, 2,5mg.
(8S,13S,14S,17R)-17-hydroxy-13-methyl-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one (CAS 80657-17-6) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: (8S,13S,14S,17R)-17-hydroxy-13-methyl-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one. InChIKey: MEHHPFQKXOUFFV-XDNAFOTISA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (8S,13S,14S,17R)-17-hydroxy-13-methyl-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChIKey | MEHHPFQKXOUFFV-XDNAFOTISA-N |
| SMILES | C[C@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@H]2O |
Computed by PubChem (NCBI)