CAS 19956-76-4 appears in our catalog under these names: 2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 95%, 4,4'–Dihydroxy–2,2',3,3',5,5'–hexamethylbiphenyl, 4,4'-Dihydroxy-2,2',3,3',5,5'-hexamethylbiphenyl, >98.0%(GC), 2,2',3,3',5,5'-Hexamethyl-[1,1'-biphenyl]-4,4'-diol, 98%, 98%, 4,4'-BI[2,3,6-TRIMETHYLPHENOL], 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 200mg, 5g, 10g, 25g, 100mg.
4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol (CAS 19956-76-4) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol. InChIKey: IOJCFCLZQBXCIQ-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 4-(4-hydroxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenol |
| InChIKey | IOJCFCLZQBXCIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C)C)C2=C(C(=C(C(=C2)C)O)C)C |
Computed by PubChem (NCBI)