CAS 84-16-2 appears in our catalog under these names: Hexestrol, Hexestrol, >95% (HPLC), Hexestrol/ 99.2% (existing batch purity), Hexestrol, 98+% , Hexestrol, 98.00%. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, Dr. Ehrenstorfer. Available pack sizes: on request, 100mg, 1g, 500mg, 10mg, 200mg, 10mM (in 1ml dmso), 10g.
4-[(3S,4R)-4-(4-hydroxyphenyl)hexan-3-yl]phenol (CAS 84-16-2) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 4-[(3S,4R)-4-(4-hydroxyphenyl)hexan-3-yl]phenol. InChIKey: PBBGSZCBWVPOOL-HDICACEKSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 4-[(3S,4R)-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChIKey | PBBGSZCBWVPOOL-HDICACEKSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)O)[C@@H](CC)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)