CAS 63013-56-9 is the registry number for 4-(1-Adamantyl)phenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-(1-adamantyl)phenyl] acetate (CAS 63013-56-9) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: [4-(1-adamantyl)phenyl] acetate. InChIKey: ARCROJYJJMBGNU-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | [4-(1-adamantyl)phenyl] acetate |
| InChIKey | ARCROJYJJMBGNU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)