CAS 791-69-5 appears in our catalog under these names: Estradiol Hemihydrate EP Impurity D (delta-9(11)-Estradiol), Estradiol Hemihydrate EP Impurity D, Estradiol Impurity 4(Estradiol EP Impurity D), ∆9(11)-Estradiol, >95% (HPLC), Estra-1,3,5(10),9(11)-tetraene-3,17beta-diol (9,11-Didehydroestradiol). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
(8S,13S,14S,17S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (CAS 791-69-5) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: (8S,13S,14S,17S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol. InChIKey: FABGTKBXHAEVKL-OWSLCNJRSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (8S,13S,14S,17S)-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| InChIKey | FABGTKBXHAEVKL-OWSLCNJRSA-N |
| SMILES | C[C@]12CC=C3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)