Products 56531-69-2
CAS 56531-69-2 is the registry number for 1-(P-Tolyl)-3-adamantanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(4-methylphenyl)adamantane-1-carboxylic acid (CAS 56531-69-2) is a chemical compound with the molecular formula C18H22O2 and a molecular weight of 270.4 g/mol. IUPAC name: 3-(4-methylphenyl)adamantane-1-carboxylic acid. InChIKey: UWPMIBVQZDSYNA-UHFFFAOYSA-N.
| Molecular formula | C18H22O2 |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 3-(4-methylphenyl)adamantane-1-carboxylic acid |
| InChIKey | UWPMIBVQZDSYNA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C23CC4CC(C2)CC(C4)(C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(4-methylphenyl)adamantane-1-carboxylic acid, 3-(p-Tolyl)adamantane-1-carboxylic acid, 1-(p-Tolyl)-3-adamantanecarboxylic acid, tricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid, 3-(4-methylphenyl)-, 3-ADAMANTANECARBOXYLIC ACID, 1-(p-TOLYL)-, 3-(p-Tolyl)adamantane-1-carboxylicacid, CBMicro_009223, Cambridge id 5142922, Oprea1_753348, (1s,3r,5R,7S)-3-(p-tolyl)adamantane-1-carboxylic acid