CAS 80854-22-4 appears in our catalog under these names: 2–(3,4–dichlorophenyl)–2–methylpropanoic acid, 2-(3,4-Dichlorophenyl)-2-methylpropanoic acid, 2-(3,4-Dichlorophenyl)-2-methylpropanoic acid 98%, 2-(3,4-Dichlorophenyl)-2-methylpropanoic acid, 98%, 98%, 2-(3,4-Dichlorophenyl)-2-methylpropanoic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g.
2-(3,4-dichlorophenyl)-2-methylpropanoic acid (CAS 80854-22-4) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-2-methylpropanoic acid. InChIKey: HABYUGCUALNAMM-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-2-methylpropanoic acid |
| InChIKey | HABYUGCUALNAMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)