Products 80959-17-7

CAS 80959-17-7 is the registry number for 5-Ketoclomazone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.

Structural formula: {0} (CAS {1})

2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione (CAS 80959-17-7) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione. InChIKey: WPSHDIROLRLHJR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO3
Molecular weight253.68 g/mol
IUPAC name2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione
InChIKeyWPSHDIROLRLHJR-UHFFFAOYSA-N
SMILESCC1(C(=O)N(OC1=O)CC2=CC=CC=C2Cl)C

Computed by PubChem (NCBI)