CAS 80959-17-7 is the registry number for 5-Ketoclomazone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione (CAS 80959-17-7) is a chemical compound with the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. IUPAC name: 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione. InChIKey: WPSHDIROLRLHJR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO3 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-1,2-oxazolidine-3,5-dione |
| InChIKey | WPSHDIROLRLHJR-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(OC1=O)CC2=CC=CC=C2Cl)C |
Computed by PubChem (NCBI)