Products 81086-62-6
CAS 81086-62-6 is the registry number for Phenyl (2S)-2-aminopropanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Phenyl (2S)-2-aminopropanoate;hydrochloride (CAS 81086-62-6) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: phenyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: LMINRJFGFHZFDX-FJXQXJEOSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | phenyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | LMINRJFGFHZFDX-FJXQXJEOSA-N |
| SMILES | C[C@@H](C(=O)OC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)