Products 81587-11-3
CAS 81587-11-3 appears in our catalog under these names: 5-Hydroxyindole-3-acetic acid-d5, 98.22%, 5-Hydroxyindole-3-acetic Acid-D5, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 2.5 mg, 2,5mg, 25mg.
2,2-dideuterio-2-(2,4,6-trideuterio-5-hydroxy-1H-indol-3-yl)acetic acid (CAS 81587-11-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 196.21 g/mol. IUPAC name: 2,2-dideuterio-2-(2,4,6-trideuterio-5-hydroxy-1H-indol-3-yl)acetic acid. InChIKey: DUUGKQCEGZLZNO-RMPOUBHVSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,4,6-trideuterio-5-hydroxy-1H-indol-3-yl)acetic acid |
| InChIKey | DUUGKQCEGZLZNO-RMPOUBHVSA-N |
| SMILES | [2H]C1=CC2=C(C(=C1O)[2H])C(=C(N2)[2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)