CAS 81607-67-2 is the registry number for H-Ser-4MbetaNA. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S)-2-amino-3-hydroxy-N-(4-methoxynaphthalen-2-yl)propanamide (CAS 81607-67-2) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: (2S)-2-amino-3-hydroxy-N-(4-methoxynaphthalen-2-yl)propanamide. InChIKey: UUXFIMTXSQJZID-LBPRGKRZSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (2S)-2-amino-3-hydroxy-N-(4-methoxynaphthalen-2-yl)propanamide |
| InChIKey | UUXFIMTXSQJZID-LBPRGKRZSA-N |
| SMILES | COC1=CC(=CC2=CC=CC=C21)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)