CAS 817172-38-6 appears in our catalog under these names: 2-(4-Methylbenzoyl)-1H-indole-3-carboxylic acid, 97%, 2-(4-Methyl-benzoyl)-1H-indole-3-carboxylic acid. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg.
2-(4-methylbenzoyl)-1H-indole-3-carboxylic acid (CAS 817172-38-6) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(4-methylbenzoyl)-1H-indole-3-carboxylic acid. InChIKey: HRELBIXQISCCSH-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(4-methylbenzoyl)-1H-indole-3-carboxylic acid |
| InChIKey | HRELBIXQISCCSH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=C(C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)