CAS 81719-53-1 is the registry number for 3,5-Dichloro-2-pyridinecarboxylic acid, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g.
3,5-dichloropyridine-2-carboxylic acid (CAS 81719-53-1) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,5-dichloropyridine-2-carboxylic acid. InChIKey: JYKZCYLZWZCQFP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,5-dichloropyridine-2-carboxylic acid |
| InChIKey | JYKZCYLZWZCQFP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)