CAS 81864-62-2 appears in our catalog under these names: 8-Nitro-3,4-dihydro-2h-1,5-benzodioxepin-7-amine, 95%, 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine, 97%, 8–Nitro–3,4–dihydro–2H–1,5–benzodioxepin–7–amine, 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine, 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 500mg, 100mg, 2,5g, 5g, 0,5g.
7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine (CAS 81864-62-2) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine. InChIKey: AFALZDMHQHIVNC-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine |
| InChIKey | AFALZDMHQHIVNC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)N)[N+](=O)[O-])OC1 |
Computed by PubChem (NCBI)