CAS 821768-22-3 is the registry number for Phenyl N-(quinolin-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Phenyl N-quinolin-3-ylcarbamate (CAS 821768-22-3) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: phenyl N-quinolin-3-ylcarbamate. InChIKey: JQFIWELAGHWNIN-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | phenyl N-quinolin-3-ylcarbamate |
| InChIKey | JQFIWELAGHWNIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)