CAS 823222-01-1 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)isonicotinic acid, 5-Chloro-2-(trifluoromethyl)isonicotinic acid, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g.
5-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid (CAS 823222-01-1) is a chemical compound with the molecular formula C7H3ClF3NO2 and a molecular weight of 225.55 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid. InChIKey: FLNMNRMAYBXCCM-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3NO2 |
|---|---|
| Molecular weight | 225.55 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChIKey | FLNMNRMAYBXCCM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)